C11H12FN — CID 126589577
3-fluoro-4-methyl-6,7-dihydro-5H-naphthalen-1-imine (PubChem CID 126589577) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 3-fluoro-4-methyl-6,7-dihydro-5H-naphthalen-1-imine.
| Compound Name | 3-fluoro-4-methyl-6,7-dihydro-5H-naphthalen-1-imine |
|---|---|
| PubChem CID | 126589577 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-fluoro-4-methyl-6,7-dihydro-5H-naphthalen-1-imine |
| SMILES | [H]/N=C1\C=C(F)C(C)=C2CCCC=C21 |
| InChI | InChI=1S/C11H12FN/c1-7-8-4-2-3-5-9(8)11(13)6-10(7)12/h5-6,13H,2-4H2,1H3/b13-11+ |
| InChIKey | IHHDXGUZAQBALG-ACCUITESSA-N |
| XLogP | 3.30 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|