C8H11Br — CID 163730925
3-bromo-1-methylcyclohepta-1,3-diene (PubChem CID 163730925) has the molecular formula C8H11Br and a molecular weight of 187.08 g/mol. Its IUPAC name is 3-bromo-1-methylcyclohepta-1,3-diene.
| Compound Name | 3-bromo-1-methylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 163730925 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 3-bromo-1-methylcyclohepta-1,3-diene |
| SMILES | CC1=CC(Br)=CCCC1 |
| InChI | InChI=1S/C8H11Br/c1-7-4-2-3-5-8(9)6-7/h5-6H,2-4H2,1H3 |
| InChIKey | KZLRWOUYSWBQJI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |