C9H14BrN — CID 143063418
3-bromo-N-ethylcyclohepta-1,3-dien-1-amine (PubChem CID 143063418) has the molecular formula C9H14BrN and a molecular weight of 216.12 g/mol. Its IUPAC name is 3-bromo-N-ethylcyclohepta-1,3-dien-1-amine.
| Compound Name | 3-bromo-N-ethylcyclohepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143063418 |
| Molecular Formula | C9H14BrN |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 3-bromo-N-ethylcyclohepta-1,3-dien-1-amine |
| SMILES | CCNC1=CC(Br)=CCCC1 |
| InChI | InChI=1S/C9H14BrN/c1-2-11-9-6-4-3-5-8(10)7-9/h5,7,11H,2-4,6H2,1H3 |
| InChIKey | ITZYGMFAERIODM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |