C9H9BrO — CID 143700536
(1E,3E,7Z)-3-bromocycloocta-1,3,7-triene-1-carbaldehyde (PubChem CID 143700536) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is (1E,3E,7Z)-3-bromocycloocta-1,3,7-triene-1-carbaldehyde.
| Compound Name | (1E,3E,7Z)-3-bromocycloocta-1,3,7-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143700536 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | (1E,3E,7Z)-3-bromocycloocta-1,3,7-triene-1-carbaldehyde |
| SMILES | O=CC1=C/C(Br)=C\CC/C=C\1 |
| InChI | InChI=1S/C9H9BrO/c10-9-5-3-1-2-4-8(6-9)7-11/h2,4-7H,1,3H2/b4-2-,8-6+,9-5+ |
| InChIKey | CZJBGRVSNBXKPR-JNSBCCCPSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|