C9H13BClNO — CID 123707999
chloro-[(1Z)-3-imino-7-methylcycloocta-1,7-dien-1-yl]borinic acid (PubChem CID 123707999) has the molecular formula C9H13BClNO and a molecular weight of 197.47 g/mol. Its IUPAC name is chloro-[(1Z)-3-imino-7-methylcycloocta-1,7-dien-1-yl]borinic acid.
| Compound Name | chloro-[(1Z)-3-imino-7-methylcycloocta-1,7-dien-1-yl]borinic acid |
|---|---|
| PubChem CID | 123707999 |
| Molecular Formula | C9H13BClNO |
| Molecular Weight | 197.47 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | chloro-[(1Z)-3-imino-7-methylcycloocta-1,7-dien-1-yl]borinic acid |
| SMILES | [H]/N=C1/C=C(/B(O)Cl)C=C(C)CCC1 |
| InChI | InChI=1S/C9H13BClNO/c1-7-3-2-4-9(12)6-8(5-7)10(11)13/h5-6,12-13H,2-4H2,1H3/b7-5?,8-6+,12-9+ |
| InChIKey | FLVGGIFPNSRADA-OVEQMOJCSA-N |
| XLogP | 2.32 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|