C10H13BrN2 — CID 123441577
4-bromo-6-ethenyl-6-methylcyclohept-3-ene-1,2-diimine (PubChem CID 123441577) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 4-bromo-6-ethenyl-6-methylcyclohept-3-ene-1,2-diimine.
| Compound Name | 4-bromo-6-ethenyl-6-methylcyclohept-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 123441577 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 4-bromo-6-ethenyl-6-methylcyclohept-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=C(Br)CC(C)(C=C)C\C1=N/[H] |
| InChI | InChI=1S/C10H13BrN2/c1-3-10(2)5-7(11)4-8(12)9(13)6-10/h3-4,12-13H,1,5-6H2,2H3/b12-8+,13-9+ |
| InChIKey | HSBJIBRJEKNLNU-QHKWOANTSA-N |
| XLogP | 3.29 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|