C21H20N2 — CID 145380913
(5Z)-4,4-dimethyl-5-[(methylideneamino)-phenylmethylidene]-3-phenylcyclopent-2-en-1-imine (PubChem CID 145380913) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is (5Z)-4,4-dimethyl-5-[(methylideneamino)-phenylmethylidene]-3-phenylcyclopent-2-en-1-imine.
| Compound Name | (5Z)-4,4-dimethyl-5-[(methylideneamino)-phenylmethylidene]-3-phenylcyclopent-2-en-1-imine |
|---|---|
| PubChem CID | 145380913 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (5Z)-4,4-dimethyl-5-[(methylideneamino)-phenylmethylidene]-3-phenylcyclopent-2-en-1-imine |
| SMILES | [H]/N=C1\C=C(c2ccccc2)C(C)(C)\C1=C(\N=C)c1ccccc1 |
| InChI | InChI=1S/C21H20N2/c1-21(2)17(15-10-6-4-7-11-15)14-18(22)19(21)20(23-3)16-12-8-5-9-13-16/h4-14,22H,3H2,1-2H3/b20-19+,22-18+ |
| InChIKey | NGHNYDFOZMIOGC-LWEJJHOBSA-N |
| XLogP | 5.24 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|