C47H41N — CID 138633412
10-(cyclopenta-2,4-dien-1-ylmethyl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-10',10'-dimethyl-7'-phenylspiro[acridine-9,9'-anthracene] (PubChem CID 138633412) has the molecular formula C47H41N and a molecular weight of 619.85 g/mol. Its IUPAC name is 10-(cyclopenta-2,4-dien-1-ylmethyl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-10',10'-dimethyl-7'-phenylspiro[acridine-9,9'-anthracene].
| Compound Name | 10-(cyclopenta-2,4-dien-1-ylmethyl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-10',10'-dimethyl-7'-phenylspiro[acridine-9,9'-anthracene] |
|---|---|
| PubChem CID | 138633412 |
| Molecular Formula | C47H41N |
| Molecular Weight | 619.85 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | 10-(cyclopenta-2,4-dien-1-ylmethyl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-10',10'-dimethyl-7'-phenylspiro[acridine-9,9'-anthracene] |
| SMILES | C=C/C=C\C=C(/C)c1ccc2c(c1)C1(c3ccccc3N(CC3C=CC=C3)c3ccccc31)c1cc(-c3ccccc3)ccc1C2(C)C |
| InChI | InChI=1S/C47H41N/c1-5-6-8-17-33(2)36-26-28-38-42(30-36)47(43-31-37(35-20-9-7-10-21-35)27-29-39(43)46(38,3)4)40-22-13-15-24-44(40)48(32-34-18-11-12-19-34)45-25-16-14-23-41(45)47/h5-31,34H,1,32H2,2-4H3/b8-6-,33-17+ |
| InChIKey | UDDGNFUDANEEJP-QKINCPHUSA-N |
| XLogP | 11.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.85 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|