C53H36N4 — CID 148514477
5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]spiro[fluorene-9,11'-indeno[1,2-b]carbazole] (PubChem CID 148514477) has the molecular formula C53H36N4 and a molecular weight of 728.90 g/mol. Its IUPAC name is 5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]spiro[fluorene-9,11'-indeno[1,2-b]carbazole].
| Compound Name | 5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]spiro[fluorene-9,11'-indeno[1,2-b]carbazole] |
|---|---|
| PubChem CID | 148514477 |
| Molecular Formula | C53H36N4 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | 5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2'-[(2E,4Z)-hepta-2,4,6-trien-2-yl]spiro[fluorene-9,11'-indeno[1,2-b]carbazole] |
| SMILES | C=C/C=C\C=C(/C)c1ccc2c(c1)c1cc3c(cc1n2-c1nc(-c2ccccc2)nc(-c2ccccc2)n1)-c1ccccc1C31c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C53H36N4/c1-3-4-7-18-34(2)37-29-30-48-42(31-37)43-32-47-41(40-25-14-17-28-46(40)53(47)44-26-15-12-23-38(44)39-24-13-16-27-45(39)53)33-49(43)57(48)52-55-50(35-19-8-5-9-20-35)54-51(56-52)36-21-10-6-11-22-36/h3-33H,1H2,2H3/b7-4-,34-18+ |
| InChIKey | MNDWCUNMRJMBDH-MCPCPUDESA-N |
| XLogP | 12.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|