C55H52O — CID 144660727
9,9-dimethyl-2-(4-methylphenyl)fluorene;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-[(1Z,3E,5E)-3-[2-(2-methylphenoxy)phenyl]hepta-1,3,5-trienyl]benzene (PubChem CID 144660727) has the molecular formula C55H52O and a molecular weight of 729.02 g/mol. Its IUPAC name is 9,9-dimethyl-2-(4-methylphenyl)fluorene;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-[(1Z,3E,5E)-3-[2-(2-methylphenoxy)phenyl]hepta-1,3,5-trienyl]benzene.
| Compound Name | 9,9-dimethyl-2-(4-methylphenyl)fluorene;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-[(1Z,3E,5E)-3-[2-(2-methylphenoxy)phenyl]hepta-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 144660727 |
| Molecular Formula | C55H52O |
| Molecular Weight | 729.02 g/mol |
| Exact Mass | 728.40 |
| IUPAC Name | 9,9-dimethyl-2-(4-methylphenyl)fluorene;1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4-[(1Z,3E,5E)-3-[2-(2-methylphenoxy)phenyl]hepta-1,3,5-trienyl]benzene |
| SMILES | C=C/C=C\C=C(/C)c1ccc(/C=C\C(=C/C=C/C)c2ccccc2Oc2ccccc2C)cc1.Cc1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C33H32O.C22H20/c1-5-7-9-14-26(3)29-23-20-28(21-24-29)22-25-30(16-8-6-2)31-17-11-13-19-33(31)34-32-18-12-10-15-27(32)4;1-15-8-10-16(11-9-15)17-12-13-19-18-6-4-5-7-20(18)22(2,3)21(19)14-17/h5-25H,1H2,2-4H3;4-14H,1-3H3/b8-6+,9-7-,25-22-,26-14+,30-16+; |
| InChIKey | LWEHEKBLJAKQOZ-XURVGOBESA-N |
| XLogP | 15.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.02 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|