C43H34 — CID 58569768
5-[(1E,3E,5E,7E)-1-(9,9-dimethylfluoren-2-yl)deca-1,3,5,7,9-pentaen-5-yl]benzo[c]phenanthrene (PubChem CID 58569768) has the molecular formula C43H34 and a molecular weight of 550.75 g/mol. Its IUPAC name is 5-[(1E,3E,5E,7E)-1-(9,9-dimethylfluoren-2-yl)deca-1,3,5,7,9-pentaen-5-yl]benzo[c]phenanthrene.
| Compound Name | 5-[(1E,3E,5E,7E)-1-(9,9-dimethylfluoren-2-yl)deca-1,3,5,7,9-pentaen-5-yl]benzo[c]phenanthrene |
|---|---|
| PubChem CID | 58569768 |
| Molecular Formula | C43H34 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 5-[(1E,3E,5E,7E)-1-(9,9-dimethylfluoren-2-yl)deca-1,3,5,7,9-pentaen-5-yl]benzo[c]phenanthrene |
| SMILES | C=C/C=C/C=C(\C=C\C=C\c1ccc2c(c1)C(C)(C)c1ccccc1-2)c1cc2ccc3ccccc3c2c2ccccc12 |
| InChI | InChI=1S/C43H34/c1-4-5-6-16-31(17-8-7-15-30-24-27-37-36-21-13-14-23-40(36)43(2,3)41(37)28-30)39-29-33-26-25-32-18-9-10-19-34(32)42(33)38-22-12-11-20-35(38)39/h4-29H,1H2,2-3H3/b6-5+,15-7+,17-8+,31-16+ |
| InChIKey | ZEBFPEXLZCBQGV-VEIOZTKASA-N |
| XLogP | 11.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|