C51H45N — CID 142481101
N-[(1E,3E,5Z)-1-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-N,9,9-trimethylfluoren-2-amine (PubChem CID 142481101) has the molecular formula C51H45N and a molecular weight of 671.93 g/mol. Its IUPAC name is N-[(1E,3E,5Z)-1-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-N,9,9-trimethylfluoren-2-amine.
| Compound Name | N-[(1E,3E,5Z)-1-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-N,9,9-trimethylfluoren-2-amine |
|---|---|
| PubChem CID | 142481101 |
| Molecular Formula | C51H45N |
| Molecular Weight | 671.93 g/mol |
| Exact Mass | 671.36 |
| IUPAC Name | N-[(1E,3E,5Z)-1-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-N,9,9-trimethylfluoren-2-amine |
| SMILES | C/C=C\C(=C/C=C/c1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2C(C)(C)c2ccccc21)N(C)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C51H45N/c1-7-17-35(52(6)36-29-31-39-37-20-8-10-22-41(37)49(2,3)47(39)33-36)19-16-18-34-28-30-40-38-21-9-11-23-42(38)51(48(40)32-34)45-26-14-12-24-43(45)50(4,5)44-25-13-15-27-46(44)51/h7-33H,1-6H3/b17-7-,18-16+,35-19+ |
| InChIKey | UTCNTXCUBDLJFO-ZHXDWYEPSA-N |
| XLogP | 12.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.93 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|