C24H23N — CID 23530073
N-(4-ethenylphenyl)-N,9,9-trimethylfluoren-2-amine (PubChem CID 23530073) has the molecular formula C24H23N and a molecular weight of 325.46 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-N,9,9-trimethylfluoren-2-amine.
| Compound Name | N-(4-ethenylphenyl)-N,9,9-trimethylfluoren-2-amine |
|---|---|
| PubChem CID | 23530073 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(4-ethenylphenyl)-N,9,9-trimethylfluoren-2-amine |
| SMILES | C=Cc1ccc(N(C)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C24H23N/c1-5-17-10-12-18(13-11-17)25(4)19-14-15-21-20-8-6-7-9-22(20)24(2,3)23(21)16-19/h5-16H,1H2,2-4H3 |
| InChIKey | PPQCRWLBXYFEDC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |