C26H23N3 — CID 144573905
N,9,9-trimethyl-N-(4-pyrimidin-2-ylphenyl)fluoren-2-amine (PubChem CID 144573905) has the molecular formula C26H23N3 and a molecular weight of 377.49 g/mol. Its IUPAC name is N,9,9-trimethyl-N-(4-pyrimidin-2-ylphenyl)fluoren-2-amine.
| Compound Name | N,9,9-trimethyl-N-(4-pyrimidin-2-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 144573905 |
| Molecular Formula | C26H23N3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N,9,9-trimethyl-N-(4-pyrimidin-2-ylphenyl)fluoren-2-amine |
| SMILES | CN(c1ccc(-c2ncccn2)cc1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C26H23N3/c1-26(2)23-8-5-4-7-21(23)22-14-13-20(17-24(22)26)29(3)19-11-9-18(10-12-19)25-27-15-6-16-28-25/h4-17H,1-3H3 |
| InChIKey | FUXIBXWKLYCTAO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |