C44H35NO — CID 90360978
N,N-bis(9,9-dimethylfluoren-2-yl)-7-ethenyldibenzofuran-3-amine (PubChem CID 90360978) has the molecular formula C44H35NO and a molecular weight of 593.77 g/mol. Its IUPAC name is N,N-bis(9,9-dimethylfluoren-2-yl)-7-ethenyldibenzofuran-3-amine.
| Compound Name | N,N-bis(9,9-dimethylfluoren-2-yl)-7-ethenyldibenzofuran-3-amine |
|---|---|
| PubChem CID | 90360978 |
| Molecular Formula | C44H35NO |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | N,N-bis(9,9-dimethylfluoren-2-yl)-7-ethenyldibenzofuran-3-amine |
| SMILES | C=Cc1ccc2c(c1)oc1cc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc12 |
| InChI | InChI=1S/C44H35NO/c1-6-27-15-19-35-36-22-18-30(26-42(36)46-41(35)23-27)45(28-16-20-33-31-11-7-9-13-37(31)43(2,3)39(33)24-28)29-17-21-34-32-12-8-10-14-38(32)44(4,5)40(34)25-29/h6-26H,1H2,2-5H3 |
| InChIKey | HIARDIJAXNIKJH-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |