C49H37N3 — CID 154930078
10-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]-10',10'-dimethylspiro[acridine-9,9'-anthracene]-2',7'-dicarbonitrile (PubChem CID 154930078) has the molecular formula C49H37N3 and a molecular weight of 667.86 g/mol. Its IUPAC name is 10-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]-10',10'-dimethylspiro[acridine-9,9'-anthracene]-2',7'-dicarbonitrile.
| Compound Name | 10-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]-10',10'-dimethylspiro[acridine-9,9'-anthracene]-2',7'-dicarbonitrile |
|---|---|
| PubChem CID | 154930078 |
| Molecular Formula | C49H37N3 |
| Molecular Weight | 667.86 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | 10-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]-10',10'-dimethylspiro[acridine-9,9'-anthracene]-2',7'-dicarbonitrile |
| SMILES | C=C/C=C\C=C(/C)c1cc(-c2ccccc2)cc(N2c3ccccc3C3(c4ccccc42)c2cc(C#N)ccc2C(C)(C)c2ccc(C#N)cc23)c1 |
| InChI | InChI=1S/C49H37N3/c1-5-6-8-15-33(2)37-28-38(36-16-9-7-10-17-36)30-39(29-37)52-46-20-13-11-18-42(46)49(43-19-12-14-21-47(43)52)44-26-34(31-50)22-24-40(44)48(3,4)41-25-23-35(32-51)27-45(41)49/h5-30H,1H2,2-4H3/b8-6-,33-15+ |
| InChIKey | FOEANHUPKWJYEM-NQLSEIMMSA-N |
| XLogP | 12.05 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.86 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|