C55H43N5S — CID 154647106
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenylphenyl]-14,14-dimethylquinolino[3,2-b]phenothiazine (PubChem CID 154647106) has the molecular formula C55H43N5S and a molecular weight of 806.05 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenylphenyl]-14,14-dimethylquinolino[3,2-b]phenothiazine.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenylphenyl]-14,14-dimethylquinolino[3,2-b]phenothiazine |
|---|---|
| PubChem CID | 154647106 |
| Molecular Formula | C55H43N5S |
| Molecular Weight | 806.05 g/mol |
| Exact Mass | 805.32 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenylphenyl]-14,14-dimethylquinolino[3,2-b]phenothiazine |
| SMILES | C=C/C=C(\C=C/C)c1cc(-c2ccccc2)cc(N2c3ccccc3Sc3cc4c(cc32)C(C)(C)c2ccccc2N4c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C55H43N5S/c1-5-20-37(21-6-2)41-32-42(38-22-10-7-11-23-38)34-43(33-41)59-47-30-18-19-31-50(47)61-51-36-48-45(35-49(51)59)55(3,4)44-28-16-17-29-46(44)60(48)54-57-52(39-24-12-8-13-25-39)56-53(58-54)40-26-14-9-15-27-40/h5-36H,1H2,2-4H3/b21-6-,37-20+ |
| InChIKey | ILUUAOCKHGZEJE-MMNKRVQHSA-N |
| XLogP | 15.06 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.05 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|