C20H32 — CID 102043795
(2S,4aS,4bR,8aR)-2-ethenyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene (PubChem CID 102043795) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (2S,4aS,4bR,8aR)-2-ethenyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene.
| Compound Name | (2S,4aS,4bR,8aR)-2-ethenyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 102043795 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (2S,4aS,4bR,8aR)-2-ethenyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(=CC[C@@H]3C(C)(C)CCC[C@]32C)C1 |
| InChI | InChI=1S/C20H32/c1-6-19(4)13-10-16-15(14-19)8-9-17-18(2,3)11-7-12-20(16,17)5/h6,8,16-17H,1,7,9-14H2,2-5H3/t16-,17+,19-,20-/m0/s1 |
| InChIKey | VCOVNILQQQZROK-HNJRGHQBSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|