C19H30O — CID 101288119
[(1R,4aS,4bS,7S,10aS)-7-ethenyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,10,10a-decahydrophenanthren-1-yl]methanol (PubChem CID 101288119) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is [(1R,4aS,4bS,7S,10aS)-7-ethenyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,10,10a-decahydrophenanthren-1-yl]methanol.
| Compound Name | [(1R,4aS,4bS,7S,10aS)-7-ethenyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,10,10a-decahydrophenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 101288119 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | [(1R,4aS,4bS,7S,10aS)-7-ethenyl-4a,7-dimethyl-1,2,3,4,4b,5,6,8,10,10a-decahydrophenanthren-1-yl]methanol |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(=CC[C@H]3[C@H](CO)CCC[C@]23C)C1 |
| InChI | InChI=1S/C19H30O/c1-4-18(2)11-9-17-14(12-18)7-8-16-15(13-20)6-5-10-19(16,17)3/h4,7,15-17,20H,1,5-6,8-13H2,2-3H3/t15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | FSJGMVSGQLKTHP-VMXHOPILSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|