C20H28O4 — CID 162842145
(1R,4aR,4bR,7R,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,7-trimethyl-2-oxo-3,4,4b,5,6,8,10,10a-octahydrophenanthrene-1-carboxylic acid (PubChem CID 162842145) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1R,4aR,4bR,7R,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,7-trimethyl-2-oxo-3,4,4b,5,6,8,10,10a-octahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aR,4bR,7R,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,7-trimethyl-2-oxo-3,4,4b,5,6,8,10,10a-octahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 162842145 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1R,4aR,4bR,7R,10R,10aR)-7-ethenyl-10-hydroxy-1,4a,7-trimethyl-2-oxo-3,4,4b,5,6,8,10,10a-octahydrophenanthrene-1-carboxylic acid |
| SMILES | C=C[C@]1(C)CC[C@@H]2C(=C[C@@H](O)[C@H]3[C@@](C)(C(=O)O)C(=O)CC[C@]23C)C1 |
| InChI | InChI=1S/C20H28O4/c1-5-18(2)8-6-13-12(11-18)10-14(21)16-19(13,3)9-7-15(22)20(16,4)17(23)24/h5,10,13-14,16,21H,1,6-9,11H2,2-4H3,(H,23,24)/t13-,14-,16-,18-,19-,20+/m1/s1 |
| InChIKey | RWGKIVMZHPDMAP-JGHPTVLTSA-N |
| XLogP | 3.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|