C27H42O9 — CID 146683085
methyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 146683085) has the molecular formula C27H42O9 and a molecular weight of 510.62 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 146683085 |
| Molecular Formula | C27H42O9 |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | methyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C=C[C@@]1(C)CCC2C(=CC[C@H]3[C@@](C)(CO[C@@H]4O[C@H](C(=O)OC)[C@@H](O)[C@@H](O)[C@@H]4O)[C@@H](O)[C@H](O)C[C@]23C)C1 |
| InChI | InChI=1S/C27H42O9/c1-6-25(2)10-9-15-14(11-25)7-8-17-26(15,3)12-16(28)22(32)27(17,4)13-35-24-20(31)18(29)19(30)21(36-24)23(33)34-5/h6-7,15-22,24,28-32H,1,8-13H2,2-5H3/t15?,16-,17-,18-,19+,20+,21+,22+,24-,25+,26-,27-/m1/s1 |
| InChIKey | OUXPXJLCEJNSBY-UUKKESKESA-N |
| XLogP | 1.06 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|