C26H41ClO10 — CID 163064801
6-[[7-(2-chloro-1-hydroxyethyl)-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163064801) has the molecular formula C26H41ClO10 and a molecular weight of 549.06 g/mol. Its IUPAC name is 6-[[7-(2-chloro-1-hydroxyethyl)-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[[7-(2-chloro-1-hydroxyethyl)-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163064801 |
| Molecular Formula | C26H41ClO10 |
| Molecular Weight | 549.06 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 6-[[7-(2-chloro-1-hydroxyethyl)-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1(C(O)CCl)CCC2C(=CCC3C2(C)CC(O)C(O)C3(C)COC2OC(C(=O)O)C(O)C(O)C2O)C1 |
| InChI | InChI=1S/C26H41ClO10/c1-24(16(29)10-27)7-6-13-12(8-24)4-5-15-25(13,2)9-14(28)21(33)26(15,3)11-36-23-19(32)17(30)18(31)20(37-23)22(34)35/h4,13-21,23,28-33H,5-11H2,1-3H3,(H,34,35) |
| InChIKey | MILSASDFCJTRLY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.06 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|