C26H38O9 — CID 163047344
(2R,3R,4R,5R,6S)-6-[[(1S,2S,3R,4aR,4bR,7R,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163047344) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-6-[[(1S,2S,3R,4aR,4bR,7R,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5R,6S)-6-[[(1S,2S,3R,4aR,4bR,7R,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163047344 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (2R,3R,4R,5R,6S)-6-[[(1S,2S,3R,4aR,4bR,7R,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C=C[C@]1(C)C=C2C=C[C@@H]3[C@](C)(C[C@@H](O)[C@@H](O)[C@]3(C)CO[C@H]3O[C@@H](C(=O)O)[C@H](O)[C@@H](O)[C@H]3O)[C@H]2CC1 |
| InChI | InChI=1S/C26H38O9/c1-5-24(2)9-8-14-13(10-24)6-7-16-25(14,3)11-15(27)21(31)26(16,4)12-34-23-19(30)17(28)18(29)20(35-23)22(32)33/h5-7,10,14-21,23,27-31H,1,8-9,11-12H2,2-4H3,(H,32,33)/t14-,15+,16+,17+,18+,19+,20+,21+,23-,24-,25+,26+/m0/s1 |
| InChIKey | DWAYJEOEXYXHTI-JKJOXQBLSA-N |
| XLogP | 0.75 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|