C32H50O13 — CID 163116350
2-[[6-[[7-ethenyl-3-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-2-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163116350) has the molecular formula C32H50O13 and a molecular weight of 642.74 g/mol. Its IUPAC name is 2-[[6-[[7-ethenyl-3-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-2-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[[6-[[7-ethenyl-3-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-2-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163116350 |
| Molecular Formula | C32H50O13 |
| Molecular Weight | 642.74 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | 2-[[6-[[7-ethenyl-3-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-2-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CC1(C)C=C2C=CC3C(C)(CC(O)C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C3(C)CO)C2CC1 |
| InChI | InChI=1S/C32H50O13/c1-5-30(2)9-8-16-15(10-30)6-7-20-31(16,3)11-17(35)27(32(20,4)14-34)45-29-26(41)24(39)22(37)19(44-29)13-42-28-25(40)23(38)21(36)18(12-33)43-28/h5-7,10,16-29,33-41H,1,8-9,11-14H2,2-4H3 |
| InChIKey | ZSUZJKQWAABKIY-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 218.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.74 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|