C26H38O10 — CID 163121544
6-[(7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-9-oxo-2,3,4,5,6,8,10,10a-octahydrophenanthren-1-yl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163121544) has the molecular formula C26H38O10 and a molecular weight of 510.58 g/mol. Its IUPAC name is 6-[(7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-9-oxo-2,3,4,5,6,8,10,10a-octahydrophenanthren-1-yl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[(7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-9-oxo-2,3,4,5,6,8,10,10a-octahydrophenanthren-1-yl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163121544 |
| Molecular Formula | C26H38O10 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 6-[(7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-9-oxo-2,3,4,5,6,8,10,10a-octahydrophenanthren-1-yl)methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C=CC1(C)CCC2=C(C1)C(=O)CC1C2(C)CC(O)C(O)C1(C)COC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C26H38O10/c1-5-24(2)7-6-13-12(9-24)14(27)8-16-25(13,3)10-15(28)21(32)26(16,4)11-35-23-19(31)17(29)18(30)20(36-23)22(33)34/h5,15-21,23,28-32H,1,6-11H2,2-4H3,(H,33,34) |
| InChIKey | BRWITXYLSBSBFD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|