C8H10N2O2 — CID 54361792
2,6-dimethoxycyclohexa-2,5-diene-1,4-diimine (PubChem CID 54361792) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,6-dimethoxycyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2,6-dimethoxycyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 54361792 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2,6-dimethoxycyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]N=C1C=C(OC)C(=N[H])C(OC)=C1 |
| InChI | InChI=1S/C8H10N2O2/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4,9-10H,1-2H3/b9-5-,10-8+ |
| InChIKey | UNAHIOROHUDVKO-APQBBXBWSA-N |
| XLogP | 1.10 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|