C24H22N6 — CID 132562966
5-(4-amino-6-imino-3-phenyliminocyclohexa-1,4-dien-1-yl)-1-N-phenylbenzene-1,2,4-triamine (PubChem CID 132562966) has the molecular formula C24H22N6 and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-(4-amino-6-imino-3-phenyliminocyclohexa-1,4-dien-1-yl)-1-N-phenylbenzene-1,2,4-triamine.
| Compound Name | 5-(4-amino-6-imino-3-phenyliminocyclohexa-1,4-dien-1-yl)-1-N-phenylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 132562966 |
| Molecular Formula | C24H22N6 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 5-(4-amino-6-imino-3-phenyliminocyclohexa-1,4-dien-1-yl)-1-N-phenylbenzene-1,2,4-triamine |
| SMILES | [H]/N=C1\C=C(N)/C(=N/c2ccccc2)C=C1c1cc(Nc2ccccc2)c(N)cc1N |
| InChI | InChI=1S/C24H22N6/c25-19-13-21(27)23(29-15-7-3-1-4-8-15)11-17(19)18-12-24(22(28)14-20(18)26)30-16-9-5-2-6-10-16/h1-14,25,30H,26-28H2/b25-19+,29-23+ |
| InChIKey | FARQDOKVQWXIRA-VLOXHBLHSA-N |
| XLogP | 4.63 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|