C23H37N — CID 142963435
4a,6-dimethyl-3-methylidene-5-[2-[(2R)-1,2,5-trimethylcyclopentyl]ethyl]-5,6,7,8-tetrahydro-4H-naphthalen-2-imine (PubChem CID 142963435) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 4a,6-dimethyl-3-methylidene-5-[2-[(2R)-1,2,5-trimethylcyclopentyl]ethyl]-5,6,7,8-tetrahydro-4H-naphthalen-2-imine.
| Compound Name | 4a,6-dimethyl-3-methylidene-5-[2-[(2R)-1,2,5-trimethylcyclopentyl]ethyl]-5,6,7,8-tetrahydro-4H-naphthalen-2-imine |
|---|---|
| PubChem CID | 142963435 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 4a,6-dimethyl-3-methylidene-5-[2-[(2R)-1,2,5-trimethylcyclopentyl]ethyl]-5,6,7,8-tetrahydro-4H-naphthalen-2-imine |
| SMILES | [H]/N=C1\C=C2CCC(C)C(CCC3(C)C(C)CC[C@H]3C)C2(C)CC1=C |
| InChI | InChI=1S/C23H37N/c1-15-7-10-19-13-21(24)16(2)14-23(19,6)20(15)11-12-22(5)17(3)8-9-18(22)4/h13,15,17-18,20,24H,2,7-12,14H2,1,3-6H3/b24-21+/t15?,17-,18?,20?,22?,23?/m1/s1 |
| InChIKey | GDOKOQFWLMIAHR-NWSPXFQJSA-N |
| XLogP | 6.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|