C19H29NO — CID 146655075
(4aR,7S)-4a,7-dimethyl-7-propanimidoyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 146655075) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (4aR,7S)-4a,7-dimethyl-7-propanimidoyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,7S)-4a,7-dimethyl-7-propanimidoyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 146655075 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (4aR,7S)-4a,7-dimethyl-7-propanimidoyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | [H]/N=C(\CC)[C@@]1(C)CCC2C(CCC3=CC(=O)CC[C@@]32C)C1 |
| InChI | InChI=1S/C19H29NO/c1-4-17(20)18(2)9-8-16-13(12-18)5-6-14-11-15(21)7-10-19(14,16)3/h11,13,16,20H,4-10,12H2,1-3H3/b20-17+/t13?,16?,18-,19-/m0/s1 |
| InChIKey | HFVOUFKUBUOYFQ-LFXMLJBBSA-N |
| XLogP | 4.93 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|