C14H23N — CID 167385019
(1E,3E,9E)-5,5,8,8-tetramethylcyclodeca-1,3,9-trien-1-amine (PubChem CID 167385019) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (1E,3E,9E)-5,5,8,8-tetramethylcyclodeca-1,3,9-trien-1-amine.
| Compound Name | (1E,3E,9E)-5,5,8,8-tetramethylcyclodeca-1,3,9-trien-1-amine |
|---|---|
| PubChem CID | 167385019 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (1E,3E,9E)-5,5,8,8-tetramethylcyclodeca-1,3,9-trien-1-amine |
| SMILES | CC1(C)/C=C/C=C(N)\C=C\C(C)(C)CC1 |
| InChI | InChI=1S/C14H23N/c1-13(2)8-5-6-12(15)7-9-14(3,4)11-10-13/h5-9H,10-11,15H2,1-4H3/b8-5+,9-7+,12-6+ |
| InChIKey | YBBRSIDRJXDLQX-FADOVEOTSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |