C10H16O — CID 77399967
6-(methoxymethylidene)-3,3-dimethylcyclohexene (PubChem CID 77399967) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 6-(methoxymethylidene)-3,3-dimethylcyclohexene.
| Compound Name | 6-(methoxymethylidene)-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 77399967 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 6-(methoxymethylidene)-3,3-dimethylcyclohexene |
| SMILES | COC=C1C=CC(C)(C)CC1 |
| InChI | InChI=1S/C10H16O/c1-10(2)6-4-9(5-7-10)8-11-3/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | DXAXPNNQFKDXGH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|