About 6-(methoxymethylidene)-3,3-dimethylcyclohexene
6-(methoxymethylidene)-3,3-dimethylcyclohexene (PubChem CID 77399967) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 6-(methoxymethylidene)-3,3-dimethylcyclohexene.
Molecular Properties
| Compound Name | 6-(methoxymethylidene)-3,3-dimethylcyclohexene |
| PubChem CID | 77399967 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 6-(methoxymethylidene)-3,3-dimethylcyclohexene |
| SMILES | COC=C1C=CC(C)(C)CC1 |
| InChI | InChI=1S/C10H16O/c1-10(2)6-4-9(5-7-10)8-11-3/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | DXAXPNNQFKDXGH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-(methoxymethylidene)-3,3-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethylidene)-3,3-dimethylcyclohexene?
The IUPAC name of 6-(methoxymethylidene)-3,3-dimethylcyclohexene (CID 77399967) is 6-(methoxymethylidene)-3,3-dimethylcyclohexene.
What is the SMILES notation for 6-(methoxymethylidene)-3,3-dimethylcyclohexene?
The canonical SMILES for 6-(methoxymethylidene)-3,3-dimethylcyclohexene is COC=C1C=CC(C)(C)CC1.
What is the InChIKey of 6-(methoxymethylidene)-3,3-dimethylcyclohexene?
The InChIKey is DXAXPNNQFKDXGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-10(2)6-4-9(5-7-10)8-11-3/h4,6,8H,5,7H2,1-3H3.
What are the key properties of 6-(methoxymethylidene)-3,3-dimethylcyclohexene?
6-(methoxymethylidene)-3,3-dimethylcyclohexene has a molecular weight of 152.24 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethylidene)-3,3-dimethylcyclohexene is sourced from PubChem (CID 77399967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).