C21H32O — CID 10063393
(1S,4S,9S,10R,13Z,14S)-13-(methoxymethylidene)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene (PubChem CID 10063393) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (1S,4S,9S,10R,13Z,14S)-13-(methoxymethylidene)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene.
| Compound Name | (1S,4S,9S,10R,13Z,14S)-13-(methoxymethylidene)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene |
|---|---|
| PubChem CID | 10063393 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (1S,4S,9S,10R,13Z,14S)-13-(methoxymethylidene)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene |
| SMILES | CO/C=C1/CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@]23C=C[C@H]13 |
| InChI | InChI=1S/C21H32O/c1-19(2)10-5-11-20(3)17(19)9-13-21-12-8-16(21)15(14-22-4)6-7-18(20)21/h8,12,14,16-18H,5-7,9-11,13H2,1-4H3/b15-14-/t16-,17+,18-,20+,21+/m1/s1 |
| InChIKey | XACMFMFGNADBPA-HKPDGKSTSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|