C20H29N — CID 11231428
(1R,4S,9S,10R,14R)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene-13-carbonitrile (PubChem CID 11231428) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (1R,4S,9S,10R,14R)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene-13-carbonitrile.
| Compound Name | (1R,4S,9S,10R,14R)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene-13-carbonitrile |
|---|---|
| PubChem CID | 11231428 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (1R,4S,9S,10R,14R)-5,5,9-trimethyltetracyclo[8.6.0.01,14.04,9]hexadec-15-ene-13-carbonitrile |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CCC(C#N)[C@H]4C=C[C@]43CC[C@@H]12 |
| InChI | InChI=1S/C20H29N/c1-18(2)9-4-10-19(3)16(18)8-12-20-11-7-15(20)14(13-21)5-6-17(19)20/h7,11,14-17H,4-6,8-10,12H2,1-3H3/t14?,15-,16+,17-,19+,20+/m1/s1 |
| InChIKey | DLPNOOCWDPKCRP-YWXVVYKXSA-N |
| XLogP | 5.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|