C21H34O — CID 101476358
(3R,4aR,4bS,10aR)-1-ethenyl-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-3-ol (PubChem CID 101476358) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (3R,4aR,4bS,10aR)-1-ethenyl-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-3-ol.
| Compound Name | (3R,4aR,4bS,10aR)-1-ethenyl-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-3-ol |
|---|---|
| PubChem CID | 101476358 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (3R,4aR,4bS,10aR)-1-ethenyl-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-3-ol |
| SMILES | C=CC1=C(C)[C@H](O)C[C@H]2[C@@]1(C)CCC1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C21H34O/c1-7-15-14(2)16(22)13-18-20(15,5)12-9-17-19(3,4)10-8-11-21(17,18)6/h7,16-18,22H,1,8-13H2,2-6H3/t16-,17?,18+,20+,21+/m1/s1 |
| InChIKey | JGZOWNZJZLRTRG-DVOCNEQMSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |