C32H46N2O4 — CID 139193831
(5aR,8R,9aS,9bR)-6-ethenyl-5a,7,9b-trimethyl-1,4,5,8,9,9a-hexahydrobenzo[e][2,1]benzoxazol-8-ol (PubChem CID 139193831) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is (5aR,8R,9aS,9bR)-6-ethenyl-5a,7,9b-trimethyl-1,4,5,8,9,9a-hexahydrobenzo[e][2,1]benzoxazol-8-ol.
| Compound Name | (5aR,8R,9aS,9bR)-6-ethenyl-5a,7,9b-trimethyl-1,4,5,8,9,9a-hexahydrobenzo[e][2,1]benzoxazol-8-ol |
|---|---|
| PubChem CID | 139193831 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | (5aR,8R,9aS,9bR)-6-ethenyl-5a,7,9b-trimethyl-1,4,5,8,9,9a-hexahydrobenzo[e][2,1]benzoxazol-8-ol |
| SMILES | C=CC1=C(C)[C@H](O)C[C@@H]2[C@@]3(C)CON=C3CC[C@@]12C.C=CC1=C(C)[C@H](O)C[C@@H]2[C@@]3(C)CON=C3CC[C@@]12C |
| InChI | InChI=1S/2C16H23NO2/c2*1-5-11-10(2)12(18)8-13-15(11,3)7-6-14-16(13,4)9-19-17-14/h2*5,12-13,18H,1,6-9H2,2-4H3/t2*12-,13+,15+,16-/m11/s1 |
| InChIKey | VJXNRZGVFVUGLN-AREFDJNFSA-N |
| XLogP | 6.12 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |