C20H28O4 — CID 162917366
(2S,3R,4R,4bS,8aR)-2-ethenyl-3,4-dihydroxy-2,4b,8,8-tetramethyl-4,5,6,8a,9,10-hexahydro-3H-phenanthrene-1,7-dione (PubChem CID 162917366) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S,3R,4R,4bS,8aR)-2-ethenyl-3,4-dihydroxy-2,4b,8,8-tetramethyl-4,5,6,8a,9,10-hexahydro-3H-phenanthrene-1,7-dione.
| Compound Name | (2S,3R,4R,4bS,8aR)-2-ethenyl-3,4-dihydroxy-2,4b,8,8-tetramethyl-4,5,6,8a,9,10-hexahydro-3H-phenanthrene-1,7-dione |
|---|---|
| PubChem CID | 162917366 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2S,3R,4R,4bS,8aR)-2-ethenyl-3,4-dihydroxy-2,4b,8,8-tetramethyl-4,5,6,8a,9,10-hexahydro-3H-phenanthrene-1,7-dione |
| SMILES | C=C[C@]1(C)C(=O)C2=C([C@@H](O)[C@@H]1O)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C20H28O4/c1-6-19(4)16(23)11-7-8-12-18(2,3)13(21)9-10-20(12,5)14(11)15(22)17(19)24/h6,12,15,17,22,24H,1,7-10H2,2-5H3/t12-,15+,17-,19+,20-/m0/s1 |
| InChIKey | DQIYJABFJIVYHD-DMGFCFIOSA-N |
| XLogP | 2.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|