C16H24N2O — CID 167632082
(5aR,9aS)-2,6,6,9a-tetramethyl-3-methylidene-1,4,5,5a,8,9-hexahydrobenzo[g]indazol-7-one (PubChem CID 167632082) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (5aR,9aS)-2,6,6,9a-tetramethyl-3-methylidene-1,4,5,5a,8,9-hexahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,9aS)-2,6,6,9a-tetramethyl-3-methylidene-1,4,5,5a,8,9-hexahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 167632082 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (5aR,9aS)-2,6,6,9a-tetramethyl-3-methylidene-1,4,5,5a,8,9-hexahydrobenzo[g]indazol-7-one |
| SMILES | C=C1C2=C(NN1C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C16H24N2O/c1-10-11-6-7-12-15(2,3)13(19)8-9-16(12,4)14(11)17-18(10)5/h12,17H,1,6-9H2,2-5H3/t12-,16-/m0/s1 |
| InChIKey | YROTXRXNQCRNLS-LRDDRELGSA-N |
| XLogP | 3.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |