C19H32O2 — CID 161423581
4,4-dimethylcyclohexane-1-carbaldehyde;(6E)-6-(methoxymethylidene)-3,3-dimethylcyclohexene (PubChem CID 161423581) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 4,4-dimethylcyclohexane-1-carbaldehyde;(6E)-6-(methoxymethylidene)-3,3-dimethylcyclohexene.
| Compound Name | 4,4-dimethylcyclohexane-1-carbaldehyde;(6E)-6-(methoxymethylidene)-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 161423581 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 4,4-dimethylcyclohexane-1-carbaldehyde;(6E)-6-(methoxymethylidene)-3,3-dimethylcyclohexene |
| SMILES | CC1(C)CCC(C=O)CC1.CO/C=C1/C=CC(C)(C)CC1 |
| InChI | InChI=1S/C10H16O.C9H16O/c1-10(2)6-4-9(5-7-10)8-11-3;1-9(2)5-3-8(7-10)4-6-9/h4,6,8H,5,7H2,1-3H3;7-8H,3-6H2,1-2H3/b9-8-; |
| InChIKey | VXBCUJAXLZDMOT-UOQXYWCXSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|