About 1-methylcycloheptane-1,4-dicarbaldehyde
1-methylcycloheptane-1,4-dicarbaldehyde (PubChem CID 154936654) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-methylcycloheptane-1,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 1-methylcycloheptane-1,4-dicarbaldehyde |
| PubChem CID | 154936654 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-methylcycloheptane-1,4-dicarbaldehyde |
| SMILES | CC1(C=O)CCCC(C=O)CC1 |
| InChI | InChI=1S/C10H16O2/c1-10(8-12)5-2-3-9(7-11)4-6-10/h7-9H,2-6H2,1H3 |
| InChIKey | DQUGGWFIFXFMTC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcycloheptane-1,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcycloheptane-1,4-dicarbaldehyde?
The IUPAC name of 1-methylcycloheptane-1,4-dicarbaldehyde (CID 154936654) is 1-methylcycloheptane-1,4-dicarbaldehyde.
What is the SMILES notation for 1-methylcycloheptane-1,4-dicarbaldehyde?
The canonical SMILES for 1-methylcycloheptane-1,4-dicarbaldehyde is CC1(C=O)CCCC(C=O)CC1.
What is the InChIKey of 1-methylcycloheptane-1,4-dicarbaldehyde?
The InChIKey is DQUGGWFIFXFMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-10(8-12)5-2-3-9(7-11)4-6-10/h7-9H,2-6H2,1H3.
What are the key properties of 1-methylcycloheptane-1,4-dicarbaldehyde?
1-methylcycloheptane-1,4-dicarbaldehyde has a molecular weight of 168.24 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcycloheptane-1,4-dicarbaldehyde is sourced from PubChem (CID 154936654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).