C10H16O2 — CID 154936654
1-methylcycloheptane-1,4-dicarbaldehyde (PubChem CID 154936654) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-methylcycloheptane-1,4-dicarbaldehyde.
| Compound Name | 1-methylcycloheptane-1,4-dicarbaldehyde |
|---|---|
| PubChem CID | 154936654 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-methylcycloheptane-1,4-dicarbaldehyde |
| SMILES | CC1(C=O)CCCC(C=O)CC1 |
| InChI | InChI=1S/C10H16O2/c1-10(8-12)5-2-3-9(7-11)4-6-10/h7-9H,2-6H2,1H3 |
| InChIKey | DQUGGWFIFXFMTC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|