C15H21BrO — CID 134835095
(6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-ol (PubChem CID 134835095) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is (6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-ol.
| Compound Name | (6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-ol |
|---|---|
| PubChem CID | 134835095 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (6R)-9-(bromomethylidene)-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-3-ol |
| SMILES | CC1=CC(O)CC(C)(C)[C@@]12C=CC(=CBr)CC2 |
| InChI | InChI=1S/C15H21BrO/c1-11-8-13(17)9-14(2,3)15(11)6-4-12(10-16)5-7-15/h4,6,8,10,13,17H,5,7,9H2,1-3H3/t13?,15-/m1/s1 |
| InChIKey | SRTATSIVYAJWEW-AWKYBWMHSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|