About 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen
4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen (PubChem CID 177223252) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen.
Molecular Properties
| Compound Name | 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen |
| PubChem CID | 177223252 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen |
| SMILES | C=CCCC(C)CC.CC1(C)C=CC(N)=CC1.[H][H] |
| InChI | InChI=1S/C8H13N.C8H16.H2/c1-8(2)5-3-7(9)4-6-8;1-4-6-7-8(3)5-2;/h3-5H,6,9H2,1-2H3;4,8H,1,5-7H2,2-3H3;1H |
| InChIKey | KLPPCBCVLXWBBU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen?
The IUPAC name of 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen (CID 177223252) is 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen.
What is the SMILES notation for 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen?
The canonical SMILES for 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen is C=CCCC(C)CC.CC1(C)C=CC(N)=CC1.[H][H].
What is the InChIKey of 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen?
The InChIKey is KLPPCBCVLXWBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C8H16.H2/c1-8(2)5-3-7(9)4-6-8;1-4-6-7-8(3)5-2;/h3-5H,6,9H2,1-2H3;4,8H,1,5-7H2,2-3H3;1H.
What are the key properties of 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen?
4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen has a molecular weight of 237.43 g/mol, XLogP of 5.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen is sourced from PubChem (CID 177223252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).