C16H31N — CID 177223252
4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen (PubChem CID 177223252) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen.
| Compound Name | 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen |
|---|---|
| PubChem CID | 177223252 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 4,4-dimethylcyclohexa-1,5-dien-1-amine;5-methylhept-1-ene;molecular hydrogen |
| SMILES | C=CCCC(C)CC.CC1(C)C=CC(N)=CC1.[H][H] |
| InChI | InChI=1S/C8H13N.C8H16.H2/c1-8(2)5-3-7(9)4-6-8;1-4-6-7-8(3)5-2;/h3-5H,6,9H2,1-2H3;4,8H,1,5-7H2,2-3H3;1H |
| InChIKey | KLPPCBCVLXWBBU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|