C10H10O — CID 90950916
5-cyclopenta-1,3-dien-1-yl-2H-pyran (PubChem CID 90950916) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-cyclopenta-1,3-dien-1-yl-2H-pyran.
| Compound Name | 5-cyclopenta-1,3-dien-1-yl-2H-pyran |
|---|---|
| PubChem CID | 90950916 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 5-cyclopenta-1,3-dien-1-yl-2H-pyran |
| SMILES | C1=CCC(C2=COCC=C2)=C1 |
| InChI | InChI=1S/C10H10O/c1-2-5-9(4-1)10-6-3-7-11-8-10/h1-4,6,8H,5,7H2 |
| InChIKey | BQGNJVDUFDAONM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |