C14H18N2 — CID 143079676
6-imino-2-methyl-5-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 143079676) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 6-imino-2-methyl-5-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-imino-2-methyl-5-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143079676 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 6-imino-2-methyl-5-(4-methylcyclohexa-2,4-dien-1-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C1/C(C2C=CC(C)=CC2)=CC=C(C)C1N |
| InChI | InChI=1S/C14H18N2/c1-9-3-6-11(7-4-9)12-8-5-10(2)13(15)14(12)16/h3-6,8,11,13,16H,7,15H2,1-2H3/b16-14- |
| InChIKey | HSEMUJDZDAYIEN-PEZBUJJGSA-N |
| XLogP | 2.74 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|