C9H16N2 — CID 163777490
[(1R)-4,7-dimethylcyclohepta-2,4-dien-1-yl]hydrazine (PubChem CID 163777490) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is [(1R)-4,7-dimethylcyclohepta-2,4-dien-1-yl]hydrazine.
| Compound Name | [(1R)-4,7-dimethylcyclohepta-2,4-dien-1-yl]hydrazine |
|---|---|
| PubChem CID | 163777490 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | [(1R)-4,7-dimethylcyclohepta-2,4-dien-1-yl]hydrazine |
| SMILES | CC1=CCC(C)[C@@H](NN)C=C1 |
| InChI | InChI=1S/C9H16N2/c1-7-3-5-8(2)9(11-10)6-4-7/h3-4,6,8-9,11H,5,10H2,1-2H3/t8?,9-/m0/s1 |
| InChIKey | MLSHEIVEUQWMDC-GKAPJAKFSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|