C14H22NO2- — CID 163896200
4-methyl-N-(4-methylcyclohexa-2,4-dien-1-yl)oxy-N-oxidocyclohexan-1-amine (PubChem CID 163896200) has the molecular formula C14H22NO2- and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-methyl-N-(4-methylcyclohexa-2,4-dien-1-yl)oxy-N-oxidocyclohexan-1-amine.
| Compound Name | 4-methyl-N-(4-methylcyclohexa-2,4-dien-1-yl)oxy-N-oxidocyclohexan-1-amine |
|---|---|
| PubChem CID | 163896200 |
| Molecular Formula | C14H22NO2- |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 4-methyl-N-(4-methylcyclohexa-2,4-dien-1-yl)oxy-N-oxidocyclohexan-1-amine |
| SMILES | CC1=CCC(ON([O-])C2CCC(C)CC2)C=C1 |
| InChI | InChI=1S/C14H22NO2/c1-11-3-7-13(8-4-11)15(16)17-14-9-5-12(2)6-10-14/h5-6,9,11,13-14H,3-4,7-8,10H2,1-2H3/q-1 |
| InChIKey | YVCVZBQJQOMSAA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|