C11H13BrO — CID 170944222
2-bromo-2-methyl-3,4,4a,5-tetrahydronaphthalen-1-one (PubChem CID 170944222) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is 2-bromo-2-methyl-3,4,4a,5-tetrahydronaphthalen-1-one.
| Compound Name | 2-bromo-2-methyl-3,4,4a,5-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 170944222 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-bromo-2-methyl-3,4,4a,5-tetrahydronaphthalen-1-one |
| SMILES | CC1(Br)CCC2CC=CC=C2C1=O |
| InChI | InChI=1S/C11H13BrO/c1-11(12)7-6-8-4-2-3-5-9(8)10(11)13/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | PRAMGLUYOBCFMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|