C10H12O2 — CID 162914428
(3aR)-3,3-dimethyl-3a,4-dihydro-2-benzofuran-1-one (PubChem CID 162914428) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (3aR)-3,3-dimethyl-3a,4-dihydro-2-benzofuran-1-one.
| Compound Name | (3aR)-3,3-dimethyl-3a,4-dihydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 162914428 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3aR)-3,3-dimethyl-3a,4-dihydro-2-benzofuran-1-one |
| SMILES | CC1(C)OC(=O)C2=CC=CC[C@H]21 |
| InChI | InChI=1S/C10H12O2/c1-10(2)8-6-4-3-5-7(8)9(11)12-10/h3-5,8H,6H2,1-2H3/t8-/m1/s1 |
| InChIKey | CMRSAXKMZYZULD-MRVPVSSYSA-N |
| XLogP | 1.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |