C9H7BrO2 — CID 163770391
3-bromo-8,8a-dihydrochromen-4-one (PubChem CID 163770391) has the molecular formula C9H7BrO2 and a molecular weight of 227.06 g/mol. Its IUPAC name is 3-bromo-8,8a-dihydrochromen-4-one.
| Compound Name | 3-bromo-8,8a-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163770391 |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 3-bromo-8,8a-dihydrochromen-4-one |
| SMILES | O=C1C(Br)=COC2CC=CC=C12 |
| InChI | InChI=1S/C9H7BrO2/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-3,5,8H,4H2 |
| InChIKey | MFXNXHIEQNLIMJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |