C12H12O2 — CID 23442946
4,5,5a,6-tetrahydro-3aH-benzo[e][1]benzofuran-2-one (PubChem CID 23442946) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4,5,5a,6-tetrahydro-3aH-benzo[e][1]benzofuran-2-one.
| Compound Name | 4,5,5a,6-tetrahydro-3aH-benzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 23442946 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4,5,5a,6-tetrahydro-3aH-benzo[e][1]benzofuran-2-one |
| SMILES | O=C1C=C2C3=CC=CCC3CCC2O1 |
| InChI | InChI=1S/C12H12O2/c13-12-7-10-9-4-2-1-3-8(9)5-6-11(10)14-12/h1-2,4,7-8,11H,3,5-6H2 |
| InChIKey | QHBDCRUGSAAFOY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |