C13H16O — CID 71367241
1,2,3,4,4a,4b,5,9a-octahydrofluoren-9-one (PubChem CID 71367241) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,9a-octahydrofluoren-9-one.
| Compound Name | 1,2,3,4,4a,4b,5,9a-octahydrofluoren-9-one |
|---|---|
| PubChem CID | 71367241 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1,2,3,4,4a,4b,5,9a-octahydrofluoren-9-one |
| SMILES | O=C1C2=CC=CCC2C2CCCCC12 |
| InChI | InChI=1S/C13H16O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1,3,7,9-10,12H,2,4-6,8H2 |
| InChIKey | TUGQRWGEMRZWEV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |